C15H15N3O5 — CID 95623336
cis-(1R,2S)-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-nitrocyclopropane-1-carboxamide (PubChem CID 95623336) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is cis-(1R,2S)-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95623336 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | cis-(1R,2S)-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-nitrocyclopropane-1-carboxamide |
| SMILES | N#CCCN(C(=O)[C@@H]1C[C@@H]1[N+](=O)[O-])c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H15N3O5/c16-4-1-5-17(15(19)11-9-12(11)18(20)21)10-2-3-13-14(8-10)23-7-6-22-13/h2-3,8,11-12H,1,5-7,9H2/t11-,12+/m1/s1 |
| InChIKey | QWYVANHJFWXDHV-NEPJUHHUSA-N |
| XLogP | 1.37 |
| TPSA | 105.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|