C16H25ClN4O2 — CID 95625511
2-chloro-6-(dimethylamino)-N-[[(2R)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]pyridine-4-carboxamide (PubChem CID 95625511) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is 2-chloro-6-(dimethylamino)-N-[[(2R)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-(dimethylamino)-N-[[(2R)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95625511 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-chloro-6-(dimethylamino)-N-[[(2R)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]pyridine-4-carboxamide |
| SMILES | COCCN1CCC[C@@H]1CNC(=O)c1cc(Cl)nc(N(C)C)c1 |
| InChI | InChI=1S/C16H25ClN4O2/c1-20(2)15-10-12(9-14(17)19-15)16(22)18-11-13-5-4-6-21(13)7-8-23-3/h9-10,13H,4-8,11H2,1-3H3,(H,18,22)/t13-/m1/s1 |
| InChIKey | DDKCFWFWRZUQBI-CYBMUJFWSA-N |
| XLogP | 1.64 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|