C18H36N2O2 — CID 95626149
(2S)-1-ethoxy-3-[methyl-[1-(4-methylcyclohexyl)piperidin-4-yl]amino]propan-2-ol (PubChem CID 95626149) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (2S)-1-ethoxy-3-[methyl-[1-(4-methylcyclohexyl)piperidin-4-yl]amino]propan-2-ol.
| Compound Name | (2S)-1-ethoxy-3-[methyl-[1-(4-methylcyclohexyl)piperidin-4-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 95626149 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | (2S)-1-ethoxy-3-[methyl-[1-(4-methylcyclohexyl)piperidin-4-yl]amino]propan-2-ol |
| SMILES | CCOC[C@@H](O)CN(C)C1CCN(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C18H36N2O2/c1-4-22-14-18(21)13-19(3)16-9-11-20(12-10-16)17-7-5-15(2)6-8-17/h15-18,21H,4-14H2,1-3H3/t15?,17?,18-/m0/s1 |
| InChIKey | NFUQYYDSSUAFEW-VJFUWPCTSA-N |
| XLogP | 2.36 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |