C15H18ClNO6 — CID 95626444
[(1R)-1-(3-chlorophenyl)-2-methoxy-2-oxoethyl] 3-(ethoxycarbonylamino)propanoate (PubChem CID 95626444) has the molecular formula C15H18ClNO6 and a molecular weight of 343.76 g/mol. Its IUPAC name is [(1R)-1-(3-chlorophenyl)-2-methoxy-2-oxoethyl] 3-(ethoxycarbonylamino)propanoate.
| Compound Name | [(1R)-1-(3-chlorophenyl)-2-methoxy-2-oxoethyl] 3-(ethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 95626444 |
| Molecular Formula | C15H18ClNO6 |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | [(1R)-1-(3-chlorophenyl)-2-methoxy-2-oxoethyl] 3-(ethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)NCCC(=O)O[C@@H](C(=O)OC)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H18ClNO6/c1-3-22-15(20)17-8-7-12(18)23-13(14(19)21-2)10-5-4-6-11(16)9-10/h4-6,9,13H,3,7-8H2,1-2H3,(H,17,20)/t13-/m1/s1 |
| InChIKey | DYRMJEXSHGQJTC-CYBMUJFWSA-N |
| XLogP | 2.23 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|