C22H36ClN3O5 — CID 67925598
1-[1-(butylcarbamoyloxy)ethyl-[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl N-butylcarbamate (PubChem CID 67925598) has the molecular formula C22H36ClN3O5 and a molecular weight of 458.00 g/mol. Its IUPAC name is 1-[1-(butylcarbamoyloxy)ethyl-[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl N-butylcarbamate.
| Compound Name | 1-[1-(butylcarbamoyloxy)ethyl-[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl N-butylcarbamate |
|---|---|
| PubChem CID | 67925598 |
| Molecular Formula | C22H36ClN3O5 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-[1-(butylcarbamoyloxy)ethyl-[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OC(C)N(CC(O)c1cccc(Cl)c1)C(C)OC(=O)NCCCC |
| InChI | InChI=1S/C22H36ClN3O5/c1-5-7-12-24-21(28)30-16(3)26(17(4)31-22(29)25-13-8-6-2)15-20(27)18-10-9-11-19(23)14-18/h9-11,14,16-17,20,27H,5-8,12-13,15H2,1-4H3,(H,24,28)(H,25,29) |
| InChIKey | KHKZWWRNCJFWNP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|