C14H17Cl2NO4 — CID 139647175
methyl (2R)-2-[(2-chloroacetyl)-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propanoate (PubChem CID 139647175) has the molecular formula C14H17Cl2NO4 and a molecular weight of 334.20 g/mol. Its IUPAC name is methyl (2R)-2-[(2-chloroacetyl)-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[(2-chloroacetyl)-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propanoate |
|---|---|
| PubChem CID | 139647175 |
| Molecular Formula | C14H17Cl2NO4 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | methyl (2R)-2-[(2-chloroacetyl)-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)N(C[C@H](O)c1cccc(Cl)c1)C(=O)CCl |
| InChI | InChI=1S/C14H17Cl2NO4/c1-9(14(20)21-2)17(13(19)7-15)8-12(18)10-4-3-5-11(16)6-10/h3-6,9,12,18H,7-8H2,1-2H3/t9-,12+/m1/s1 |
| InChIKey | DESXRJBAPRAVLA-SKDRFNHKSA-N |
| XLogP | 2.00 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|