C21H35N3O4 — CID 23342619
1-[N-[1-(butylcarbamoyloxy)ethyl]-3-methylanilino]ethyl N-butylcarbamate (PubChem CID 23342619) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-[N-[1-(butylcarbamoyloxy)ethyl]-3-methylanilino]ethyl N-butylcarbamate.
| Compound Name | 1-[N-[1-(butylcarbamoyloxy)ethyl]-3-methylanilino]ethyl N-butylcarbamate |
|---|---|
| PubChem CID | 23342619 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 1-[N-[1-(butylcarbamoyloxy)ethyl]-3-methylanilino]ethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OC(C)N(c1cccc(C)c1)C(C)OC(=O)NCCCC |
| InChI | InChI=1S/C21H35N3O4/c1-6-8-13-22-20(25)27-17(4)24(19-12-10-11-16(3)15-19)18(5)28-21(26)23-14-9-7-2/h10-12,15,17-18H,6-9,13-14H2,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | DYXMKVXEVXGIPH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|