C18H28N2O2S — CID 95626525
(2R)-N-[2-methyl-2-(1-oxo-1,4-thiazinan-4-yl)propyl]-2-phenylbutanamide (PubChem CID 95626525) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is (2R)-N-[2-methyl-2-(1-oxo-1,4-thiazinan-4-yl)propyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[2-methyl-2-(1-oxo-1,4-thiazinan-4-yl)propyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 95626525 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (2R)-N-[2-methyl-2-(1-oxo-1,4-thiazinan-4-yl)propyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)NCC(C)(C)N1CCS(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C18H28N2O2S/c1-4-16(15-8-6-5-7-9-15)17(21)19-14-18(2,3)20-10-12-23(22)13-11-20/h5-9,16H,4,10-14H2,1-3H3,(H,19,21)/t16-/m1/s1 |
| InChIKey | BUNNEMSXHKNJPA-MRXNPFEDSA-N |
| XLogP | 2.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |