C16H19NO3 — CID 95627890
(3S)-3-methyl-1-oxo-N-[(E)-pent-3-enyl]-4H-isochromene-3-carboxamide (PubChem CID 95627890) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (3S)-3-methyl-1-oxo-N-[(E)-pent-3-enyl]-4H-isochromene-3-carboxamide.
| Compound Name | (3S)-3-methyl-1-oxo-N-[(E)-pent-3-enyl]-4H-isochromene-3-carboxamide |
|---|---|
| PubChem CID | 95627890 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (3S)-3-methyl-1-oxo-N-[(E)-pent-3-enyl]-4H-isochromene-3-carboxamide |
| SMILES | C/C=C/CCNC(=O)[C@]1(C)Cc2ccccc2C(=O)O1 |
| InChI | InChI=1S/C16H19NO3/c1-3-4-7-10-17-15(19)16(2)11-12-8-5-6-9-13(12)14(18)20-16/h3-6,8-9H,7,10-11H2,1-2H3,(H,17,19)/b4-3+/t16-/m0/s1 |
| InChIKey | YSMGHGJRDKPIPL-CWDCEQMOSA-N |
| XLogP | 2.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|