C16H18F3NO4 — CID 86930562
3-methyl-1-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]-4H-isochromene-3-carboxamide (PubChem CID 86930562) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is 3-methyl-1-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]-4H-isochromene-3-carboxamide.
| Compound Name | 3-methyl-1-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]-4H-isochromene-3-carboxamide |
|---|---|
| PubChem CID | 86930562 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-methyl-1-oxo-N-[3-(2,2,2-trifluoroethoxy)propyl]-4H-isochromene-3-carboxamide |
| SMILES | CC1(C(=O)NCCCOCC(F)(F)F)Cc2ccccc2C(=O)O1 |
| InChI | InChI=1S/C16H18F3NO4/c1-15(9-11-5-2-3-6-12(11)13(21)24-15)14(22)20-7-4-8-23-10-16(17,18)19/h2-3,5-6H,4,7-10H2,1H3,(H,20,22) |
| InChIKey | HLXAGRZNFSJLHI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|