C22H28N4O3S — CID 55396116
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-methyl-1-oxo-4H-isochromene-3-carboxamide (PubChem CID 55396116) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-methyl-1-oxo-4H-isochromene-3-carboxamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-methyl-1-oxo-4H-isochromene-3-carboxamide |
|---|---|
| PubChem CID | 55396116 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-3-methyl-1-oxo-4H-isochromene-3-carboxamide |
| SMILES | CSc1nnc(CCCNC(=O)C2(C)Cc3ccccc3C(=O)O2)n1C1CCCC1 |
| InChI | InChI=1S/C22H28N4O3S/c1-22(14-15-8-3-6-11-17(15)19(27)29-22)20(28)23-13-7-12-18-24-25-21(30-2)26(18)16-9-4-5-10-16/h3,6,8,11,16H,4-5,7,9-10,12-14H2,1-2H3,(H,23,28) |
| InChIKey | GPDQBAZYSIMONS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|