C16H23ClN2O4 — CID 95627920
methyl (2R)-3-[(2-chloropyridine-4-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoate (PubChem CID 95627920) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is methyl (2R)-3-[(2-chloropyridine-4-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoate.
| Compound Name | methyl (2R)-3-[(2-chloropyridine-4-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 95627920 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | methyl (2R)-3-[(2-chloropyridine-4-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoate |
| SMILES | CCOCCCN(C[C@@H](C)C(=O)OC)C(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C16H23ClN2O4/c1-4-23-9-5-8-19(11-12(2)16(21)22-3)15(20)13-6-7-18-14(17)10-13/h6-7,10,12H,4-5,8-9,11H2,1-3H3/t12-/m1/s1 |
| InChIKey | BZGSBRLQSIJASW-GFCCVEGCSA-N |
| XLogP | 2.41 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|