C15H21ClN2O4 — CID 120520331
3-[(5-chloropyridine-2-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoic acid (PubChem CID 120520331) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is 3-[(5-chloropyridine-2-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[(5-chloropyridine-2-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120520331 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-[(5-chloropyridine-2-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoic acid |
| SMILES | CCOCCCN(CC(C)C(=O)O)C(=O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H21ClN2O4/c1-3-22-8-4-7-18(10-11(2)15(20)21)14(19)13-6-5-12(16)9-17-13/h5-6,9,11H,3-4,7-8,10H2,1-2H3,(H,20,21) |
| InChIKey | RDOFXEBUIFUYFD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|