C16H24N2O4 — CID 120520296
3-[3-ethoxypropyl-(3-methylpyridine-2-carbonyl)amino]-2-methylpropanoic acid (PubChem CID 120520296) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-[3-ethoxypropyl-(3-methylpyridine-2-carbonyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[3-ethoxypropyl-(3-methylpyridine-2-carbonyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120520296 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-[3-ethoxypropyl-(3-methylpyridine-2-carbonyl)amino]-2-methylpropanoic acid |
| SMILES | CCOCCCN(CC(C)C(=O)O)C(=O)c1ncccc1C |
| InChI | InChI=1S/C16H24N2O4/c1-4-22-10-6-9-18(11-13(3)16(20)21)15(19)14-12(2)7-5-8-17-14/h5,7-8,13H,4,6,9-11H2,1-3H3,(H,20,21) |
| InChIKey | SMABIAZQVRTOSR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|