C16H26N2O4 — CID 119208438
3-[(1,5-dimethylpyrrole-2-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoic acid (PubChem CID 119208438) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 3-[(1,5-dimethylpyrrole-2-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[(1,5-dimethylpyrrole-2-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119208438 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 3-[(1,5-dimethylpyrrole-2-carbonyl)-(3-ethoxypropyl)amino]-2-methylpropanoic acid |
| SMILES | CCOCCCN(CC(C)C(=O)O)C(=O)c1ccc(C)n1C |
| InChI | InChI=1S/C16H26N2O4/c1-5-22-10-6-9-18(11-12(2)16(20)21)15(19)14-8-7-13(3)17(14)4/h7-8,12H,5-6,9-11H2,1-4H3,(H,20,21) |
| InChIKey | TXXVUCMWDCGPMQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|