C20H25FN2O4 — CID 119208299
3-[3-ethoxypropyl-(7-fluoro-2-methylquinoline-3-carbonyl)amino]-2-methylpropanoic acid (PubChem CID 119208299) has the molecular formula C20H25FN2O4 and a molecular weight of 376.43 g/mol. Its IUPAC name is 3-[3-ethoxypropyl-(7-fluoro-2-methylquinoline-3-carbonyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[3-ethoxypropyl-(7-fluoro-2-methylquinoline-3-carbonyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119208299 |
| Molecular Formula | C20H25FN2O4 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-[3-ethoxypropyl-(7-fluoro-2-methylquinoline-3-carbonyl)amino]-2-methylpropanoic acid |
| SMILES | CCOCCCN(CC(C)C(=O)O)C(=O)c1cc2ccc(F)cc2nc1C |
| InChI | InChI=1S/C20H25FN2O4/c1-4-27-9-5-8-23(12-13(2)20(25)26)19(24)17-10-15-6-7-16(21)11-18(15)22-14(17)3/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3,(H,25,26) |
| InChIKey | RMFIPTJWMZROME-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|