C14H16Cl2N2O3 — CID 95631575
trans-3-(carbamoylamino)propyl (1S,2S)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylate (PubChem CID 95631575) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is trans-3-(carbamoylamino)propyl (1S,2S)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylate.
| Compound Name | trans-3-(carbamoylamino)propyl (1S,2S)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 95631575 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | trans-3-(carbamoylamino)propyl (1S,2S)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylate |
| SMILES | NC(=O)NCCCOC(=O)[C@H]1C[C@@H]1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H16Cl2N2O3/c15-11-4-1-3-8(12(11)16)9-7-10(9)13(19)21-6-2-5-18-14(17)20/h1,3-4,9-10H,2,5-7H2,(H3,17,18,20)/t9-,10+/m1/s1 |
| InChIKey | VXMXPQMXSIWVQN-ZJUUUORDSA-N |
| XLogP | 2.70 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|