C13H20N2O — CID 95632872
2-[[(3S)-3-ethoxypiperidin-1-yl]methyl]pyridine (PubChem CID 95632872) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-[[(3S)-3-ethoxypiperidin-1-yl]methyl]pyridine.
| Compound Name | 2-[[(3S)-3-ethoxypiperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 95632872 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-[[(3S)-3-ethoxypiperidin-1-yl]methyl]pyridine |
| SMILES | CCO[C@H]1CCCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C13H20N2O/c1-2-16-13-7-5-9-15(11-13)10-12-6-3-4-8-14-12/h3-4,6,8,13H,2,5,7,9-11H2,1H3/t13-/m0/s1 |
| InChIKey | QVJGVDQKZXUTAK-ZDUSSCGKSA-N |
| XLogP | 2.08 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |