C17H25NO3S — CID 95632917
(2R,4R)-2-methyl-4-(2-methylphenyl)-1-(oxan-4-ylsulfonyl)pyrrolidine (PubChem CID 95632917) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (2R,4R)-2-methyl-4-(2-methylphenyl)-1-(oxan-4-ylsulfonyl)pyrrolidine.
| Compound Name | (2R,4R)-2-methyl-4-(2-methylphenyl)-1-(oxan-4-ylsulfonyl)pyrrolidine |
|---|---|
| PubChem CID | 95632917 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2R,4R)-2-methyl-4-(2-methylphenyl)-1-(oxan-4-ylsulfonyl)pyrrolidine |
| SMILES | Cc1ccccc1[C@H]1C[C@@H](C)N(S(=O)(=O)C2CCOCC2)C1 |
| InChI | InChI=1S/C17H25NO3S/c1-13-5-3-4-6-17(13)15-11-14(2)18(12-15)22(19,20)16-7-9-21-10-8-16/h3-6,14-16H,7-12H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | PNUOPAGRTXGNER-CABCVRRESA-N |
| XLogP | 2.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |