C17H25NO3S — CID 75373974
2-(2,3-dimethylphenyl)-1-(oxan-4-ylsulfonyl)pyrrolidine (PubChem CID 75373974) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-1-(oxan-4-ylsulfonyl)pyrrolidine.
| Compound Name | 2-(2,3-dimethylphenyl)-1-(oxan-4-ylsulfonyl)pyrrolidine |
|---|---|
| PubChem CID | 75373974 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-1-(oxan-4-ylsulfonyl)pyrrolidine |
| SMILES | Cc1cccc(C2CCCN2S(=O)(=O)C2CCOCC2)c1C |
| InChI | InChI=1S/C17H25NO3S/c1-13-5-3-6-16(14(13)2)17-7-4-10-18(17)22(19,20)15-8-11-21-12-9-15/h3,5-6,15,17H,4,7-12H2,1-2H3 |
| InChIKey | IQYVSPQEPBFECM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |