C20H26N4O — CID 95632987
1-[(2S,4S)-1-benzyl-2-methylpiperidin-4-yl]-1-methyl-3-pyridin-4-ylurea (PubChem CID 95632987) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[(2S,4S)-1-benzyl-2-methylpiperidin-4-yl]-1-methyl-3-pyridin-4-ylurea.
| Compound Name | 1-[(2S,4S)-1-benzyl-2-methylpiperidin-4-yl]-1-methyl-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 95632987 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-[(2S,4S)-1-benzyl-2-methylpiperidin-4-yl]-1-methyl-3-pyridin-4-ylurea |
| SMILES | C[C@H]1C[C@@H](N(C)C(=O)Nc2ccncc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H26N4O/c1-16-14-19(10-13-24(16)15-17-6-4-3-5-7-17)23(2)20(25)22-18-8-11-21-12-9-18/h3-9,11-12,16,19H,10,13-15H2,1-2H3,(H,21,22,25)/t16-,19-/m0/s1 |
| InChIKey | UKGHDXPLLDGSOP-LPHOPBHVSA-N |
| XLogP | 3.60 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |