About (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide
(2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide (PubChem CID 124693760) has the molecular formula C23H31N3O
and a molecular weight of 365.52 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide |
| PubChem CID | 124693760 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide |
| SMILES | C[C@@H]1C[C@H](N(C)C(=O)[C@@H](N)Cc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C23H31N3O/c1-18-15-21(13-14-26(18)17-20-11-7-4-8-12-20)25(2)23(27)22(24)16-19-9-5-3-6-10-19/h3-12,18,21-22H,13-17,24H2,1-2H3/t18-,21-,22+/m1/s1 |
| InChIKey | QRWVCWFJLBDUPE-QIJUGHKUSA-N |
| XLogP | 3.07 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide?
The IUPAC name of (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide (CID 124693760) is (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide.
What is the SMILES notation for (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide?
The canonical SMILES for (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide is C[C@@H]1C[C@H](N(C)C(=O)[C@@H](N)Cc2ccccc2)CCN1Cc1ccccc1.
What is the InChIKey of (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide?
The InChIKey is QRWVCWFJLBDUPE-QIJUGHKUSA-N. The full InChI is InChI=1S/C23H31N3O/c1-18-15-21(13-14-26(18)17-20-11-7-4-8-12-20)25(2)23(27)22(24)16-19-9-5-3-6-10-19/h3-12,18,21-22H,13-17,24H2,1-2H3/t18-,21-,22+/m1/s1.
What are the key properties of (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide?
(2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide has a molecular weight of 365.52 g/mol, XLogP of 3.07, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[(2R,4R)-1-benzyl-2-methylpiperidin-4-yl]-N-methyl-3-phenylpropanamide is sourced from PubChem (CID 124693760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).