C23H33Cl2N3O — CID 119883047
3-amino-N-(1-benzyl-2-methylpiperidin-4-yl)-N-methyl-2-phenylpropanamide;dihydrochloride (PubChem CID 119883047) has the molecular formula C23H33Cl2N3O and a molecular weight of 438.44 g/mol. Its IUPAC name is 3-amino-N-(1-benzyl-2-methylpiperidin-4-yl)-N-methyl-2-phenylpropanamide;dihydrochloride.
| Compound Name | 3-amino-N-(1-benzyl-2-methylpiperidin-4-yl)-N-methyl-2-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119883047 |
| Molecular Formula | C23H33Cl2N3O |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-amino-N-(1-benzyl-2-methylpiperidin-4-yl)-N-methyl-2-phenylpropanamide;dihydrochloride |
| SMILES | CC1CC(N(C)C(=O)C(CN)c2ccccc2)CCN1Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C23H31N3O.2ClH/c1-18-15-21(13-14-26(18)17-19-9-5-3-6-10-19)25(2)23(27)22(16-24)20-11-7-4-8-12-20;;/h3-12,18,21-22H,13-17,24H2,1-2H3;2*1H |
| InChIKey | PQFKFLDINZWZOT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |