About pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate
pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate (PubChem CID 95633577) has the molecular formula C15H14F3NO4
and a molecular weight of 329.27 g/mol. Its IUPAC name is pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate |
| PubChem CID | 95633577 |
| Molecular Formula | C15H14F3NO4 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate |
| SMILES | Cc1ccc([C@@](O)(CC(=O)OCc2ccccn2)C(F)(F)F)o1 |
| InChI | InChI=1S/C15H14F3NO4/c1-10-5-6-12(23-10)14(21,15(16,17)18)8-13(20)22-9-11-4-2-3-7-19-11/h2-7,21H,8-9H2,1H3/t14-/m0/s1 |
| InChIKey | AHOCFMVCMWNYCO-AWEZNQCLSA-N |
| XLogP | 2.87 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate?
The IUPAC name of pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate (CID 95633577) is pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate.
What is the SMILES notation for pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate?
The canonical SMILES for pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate is Cc1ccc([C@@](O)(CC(=O)OCc2ccccn2)C(F)(F)F)o1.
What is the InChIKey of pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate?
The InChIKey is AHOCFMVCMWNYCO-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H14F3NO4/c1-10-5-6-12(23-10)14(21,15(16,17)18)8-13(20)22-9-11-4-2-3-7-19-11/h2-7,21H,8-9H2,1H3/t14-/m0/s1.
What are the key properties of pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate?
pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate has a molecular weight of 329.27 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl (3S)-4,4,4-trifluoro-3-hydroxy-3-(5-methylfuran-2-yl)butanoate is sourced from PubChem (CID 95633577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).