C20H30N2O2 — CID 95635350
N-[(2R)-2-cyclohexyl-2-(cyclopent-3-ene-1-carbonylamino)ethyl]cyclopent-3-ene-1-carboxamide (PubChem CID 95635350) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is N-[(2R)-2-cyclohexyl-2-(cyclopent-3-ene-1-carbonylamino)ethyl]cyclopent-3-ene-1-carboxamide.
| Compound Name | N-[(2R)-2-cyclohexyl-2-(cyclopent-3-ene-1-carbonylamino)ethyl]cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95635350 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | N-[(2R)-2-cyclohexyl-2-(cyclopent-3-ene-1-carbonylamino)ethyl]cyclopent-3-ene-1-carboxamide |
| SMILES | O=C(NC[C@H](NC(=O)C1CC=CC1)C1CCCCC1)C1CC=CC1 |
| InChI | InChI=1S/C20H30N2O2/c23-19(16-10-4-5-11-16)21-14-18(15-8-2-1-3-9-15)22-20(24)17-12-6-7-13-17/h4-7,15-18H,1-3,8-14H2,(H,21,23)(H,22,24)/t18-/m0/s1 |
| InChIKey | DJORYXSGIDLYFH-SFHVURJKSA-N |
| XLogP | 3.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|