C15H24N2O4 — CID 95635554
1-(3,5-dimethoxyphenyl)-3-[(2R,4R)-4-hydroxy-2-methylpentyl]urea (PubChem CID 95635554) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[(2R,4R)-4-hydroxy-2-methylpentyl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[(2R,4R)-4-hydroxy-2-methylpentyl]urea |
|---|---|
| PubChem CID | 95635554 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[(2R,4R)-4-hydroxy-2-methylpentyl]urea |
| SMILES | COc1cc(NC(=O)NC[C@H](C)C[C@@H](C)O)cc(OC)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-10(5-11(2)18)9-16-15(19)17-12-6-13(20-3)8-14(7-12)21-4/h6-8,10-11,18H,5,9H2,1-4H3,(H2,16,17,19)/t10-,11-/m1/s1 |
| InChIKey | KMLRVGLRCPSKPY-GHMZBOCLSA-N |
| XLogP | 2.23 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |