C14H20F2N2O2 — CID 95981533
1-[3-(difluoromethyl)phenyl]-3-[(2R,4R)-4-hydroxy-2-methylpentyl]urea (PubChem CID 95981533) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)phenyl]-3-[(2R,4R)-4-hydroxy-2-methylpentyl]urea.
| Compound Name | 1-[3-(difluoromethyl)phenyl]-3-[(2R,4R)-4-hydroxy-2-methylpentyl]urea |
|---|---|
| PubChem CID | 95981533 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[3-(difluoromethyl)phenyl]-3-[(2R,4R)-4-hydroxy-2-methylpentyl]urea |
| SMILES | C[C@@H](CNC(=O)Nc1cccc(C(F)F)c1)C[C@@H](C)O |
| InChI | InChI=1S/C14H20F2N2O2/c1-9(6-10(2)19)8-17-14(20)18-12-5-3-4-11(7-12)13(15)16/h3-5,7,9-10,13,19H,6,8H2,1-2H3,(H2,17,18,20)/t9-,10-/m1/s1 |
| InChIKey | GMXVBABUZBAXGC-NXEZZACHSA-N |
| XLogP | 3.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |