C16H22N2O3S — CID 95635785
[2-(ethylamino)-2-oxoethyl] (2S)-2-phenyl-2-thiomorpholin-4-ylacetate (PubChem CID 95635785) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] (2S)-2-phenyl-2-thiomorpholin-4-ylacetate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] (2S)-2-phenyl-2-thiomorpholin-4-ylacetate |
|---|---|
| PubChem CID | 95635785 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] (2S)-2-phenyl-2-thiomorpholin-4-ylacetate |
| SMILES | CCNC(=O)COC(=O)[C@H](c1ccccc1)N1CCSCC1 |
| InChI | InChI=1S/C16H22N2O3S/c1-2-17-14(19)12-21-16(20)15(13-6-4-3-5-7-13)18-8-10-22-11-9-18/h3-7,15H,2,8-12H2,1H3,(H,17,19)/t15-/m0/s1 |
| InChIKey | OLHBDHOPMPZMTO-HNNXBMFYSA-N |
| XLogP | 1.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |