C15H25Cl2N3OS — CID 120505334
N-[(2S)-1-aminopropan-2-yl]-2-phenyl-2-thiomorpholin-4-ylacetamide;dihydrochloride (PubChem CID 120505334) has the molecular formula C15H25Cl2N3OS and a molecular weight of 366.36 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-phenyl-2-thiomorpholin-4-ylacetamide;dihydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-phenyl-2-thiomorpholin-4-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 120505334 |
| Molecular Formula | C15H25Cl2N3OS |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-phenyl-2-thiomorpholin-4-ylacetamide;dihydrochloride |
| SMILES | C[C@@H](CN)NC(=O)C(c1ccccc1)N1CCSCC1.Cl.Cl |
| InChI | InChI=1S/C15H23N3OS.2ClH/c1-12(11-16)17-15(19)14(13-5-3-2-4-6-13)18-7-9-20-10-8-18;;/h2-6,12,14H,7-11,16H2,1H3,(H,17,19);2*1H/t12-,14?;;/m0../s1 |
| InChIKey | REHYOPYWKSWKPD-MRWARIEHSA-N |
| XLogP | 2.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |