C16H28Cl2N4O — CID 120506442
N-[(2S)-1-aminopropan-2-yl]-2-(4-methylpiperazin-1-yl)-2-phenylacetamide;dihydrochloride (PubChem CID 120506442) has the molecular formula C16H28Cl2N4O and a molecular weight of 363.33 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-(4-methylpiperazin-1-yl)-2-phenylacetamide;dihydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-(4-methylpiperazin-1-yl)-2-phenylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 120506442 |
| Molecular Formula | C16H28Cl2N4O |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-(4-methylpiperazin-1-yl)-2-phenylacetamide;dihydrochloride |
| SMILES | C[C@@H](CN)NC(=O)C(c1ccccc1)N1CCN(C)CC1.Cl.Cl |
| InChI | InChI=1S/C16H26N4O.2ClH/c1-13(12-17)18-16(21)15(14-6-4-3-5-7-14)20-10-8-19(2)9-11-20;;/h3-7,13,15H,8-12,17H2,1-2H3,(H,18,21);2*1H/t13-,15?;;/m0../s1 |
| InChIKey | AQDAGYHOYVJKDQ-GMDIQBKMSA-N |
| XLogP | 1.28 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |