C20H23NO2S — CID 95637474
[(2S)-2-benzylpiperidin-1-yl]-[4-[(R)-methylsulfinyl]phenyl]methanone (PubChem CID 95637474) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is [(2S)-2-benzylpiperidin-1-yl]-[4-[(R)-methylsulfinyl]phenyl]methanone.
| Compound Name | [(2S)-2-benzylpiperidin-1-yl]-[4-[(R)-methylsulfinyl]phenyl]methanone |
|---|---|
| PubChem CID | 95637474 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [(2S)-2-benzylpiperidin-1-yl]-[4-[(R)-methylsulfinyl]phenyl]methanone |
| SMILES | C[S@@](=O)c1ccc(C(=O)N2CCCC[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO2S/c1-24(23)19-12-10-17(11-13-19)20(22)21-14-6-5-9-18(21)15-16-7-3-2-4-8-16/h2-4,7-8,10-13,18H,5-6,9,14-15H2,1H3/t18-,24+/m0/s1 |
| InChIKey | UJJMSSYVJFLDNC-MHECFPHRSA-N |
| XLogP | 3.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |