C17H23N5O — CID 95715174
7-[[(3R)-oxolan-3-yl]methyl]-3-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine (PubChem CID 95715174) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 7-[[(3R)-oxolan-3-yl]methyl]-3-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine.
| Compound Name | 7-[[(3R)-oxolan-3-yl]methyl]-3-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 95715174 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 7-[[(3R)-oxolan-3-yl]methyl]-3-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
| SMILES | c1cncc(Cc2nnc3n2CCN(C[C@H]2CCOC2)CC3)c1 |
| InChI | InChI=1S/C17H23N5O/c1-2-14(11-18-5-1)10-17-20-19-16-3-6-21(7-8-22(16)17)12-15-4-9-23-13-15/h1-2,5,11,15H,3-4,6-10,12-13H2/t15-/m1/s1 |
| InChIKey | PJYKZSNTZYBCNO-OAHLLOKOSA-N |
| XLogP | 1.16 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |