C18H21N7O2 — CID 56909198
methyl 4-[[3-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methyl]-1H-pyrazole-5-carboxylate (PubChem CID 56909198) has the molecular formula C18H21N7O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is methyl 4-[[3-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methyl]-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 4-[[3-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methyl]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 56909198 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | methyl 4-[[3-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]methyl]-1H-pyrazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]ncc1CN1CCc2nnc(Cc3cccnc3)n2CC1 |
| InChI | InChI=1S/C18H21N7O2/c1-27-18(26)17-14(11-20-23-17)12-24-6-4-15-21-22-16(25(15)8-7-24)9-13-3-2-5-19-10-13/h2-3,5,10-11H,4,6-9,12H2,1H3,(H,20,23) |
| InChIKey | REXXWPABGUAQLT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |