C15H20N4O2S — CID 95716429
(2S)-N-benzyl-2-(pyrazol-1-ylmethyl)pyrrolidine-1-sulfonamide (PubChem CID 95716429) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is (2S)-N-benzyl-2-(pyrazol-1-ylmethyl)pyrrolidine-1-sulfonamide.
| Compound Name | (2S)-N-benzyl-2-(pyrazol-1-ylmethyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 95716429 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2S)-N-benzyl-2-(pyrazol-1-ylmethyl)pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)N1CCC[C@H]1Cn1cccn1 |
| InChI | InChI=1S/C15H20N4O2S/c20-22(21,17-12-14-6-2-1-3-7-14)19-11-4-8-15(19)13-18-10-5-9-16-18/h1-3,5-7,9-10,15,17H,4,8,11-13H2/t15-/m0/s1 |
| InChIKey | COYHJAHNFJWTPF-HNNXBMFYSA-N |
| XLogP | 1.38 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |