C16H18N4O2 — CID 95716878
(5R)-9-quinoxalin-2-yl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one (PubChem CID 95716878) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (5R)-9-quinoxalin-2-yl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one.
| Compound Name | (5R)-9-quinoxalin-2-yl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 95716878 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (5R)-9-quinoxalin-2-yl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
| SMILES | O=C1NC[C@]2(CCCN(c3cnc4ccccc4n3)CC2)O1 |
| InChI | InChI=1S/C16H18N4O2/c21-15-18-11-16(22-15)6-3-8-20(9-7-16)14-10-17-12-4-1-2-5-13(12)19-14/h1-2,4-5,10H,3,6-9,11H2,(H,18,21)/t16-/m1/s1 |
| InChIKey | ALIPWZPYBHYKSR-MRXNPFEDSA-N |
| XLogP | 2.10 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |