C20H24FN3O3 — CID 95717790
(5R)-9-[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]-3-methyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one (PubChem CID 95717790) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is (5R)-9-[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]-3-methyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one.
| Compound Name | (5R)-9-[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]-3-methyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 95717790 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (5R)-9-[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]-3-methyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
| SMILES | Cc1[nH]c2c(F)cccc2c1CC(=O)N1CCC[C@@]2(CC1)CN(C)C(=O)O2 |
| InChI | InChI=1S/C20H24FN3O3/c1-13-15(14-5-3-6-16(21)18(14)22-13)11-17(25)24-9-4-7-20(8-10-24)12-23(2)19(26)27-20/h3,5-6,22H,4,7-12H2,1-2H3/t20-/m1/s1 |
| InChIKey | JCRNVNVMPHOSQS-HXUWFJFHSA-N |
| XLogP | 2.99 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|