C23H25FN2O3 — CID 97131804
1-[(3S)-3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-2-(7-fluoro-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 97131804) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is 1-[(3S)-3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-2-(7-fluoro-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[(3S)-3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-2-(7-fluoro-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 97131804 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[(3S)-3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-2-(7-fluoro-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | COc1cccc([C@@H]2CCN(C(=O)Cc3c(C)[nH]c4c(F)cccc34)C2)c1OC |
| InChI | InChI=1S/C23H25FN2O3/c1-14-18(17-7-4-8-19(24)22(17)25-14)12-21(27)26-11-10-15(13-26)16-6-5-9-20(28-2)23(16)29-3/h4-9,15,25H,10-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | CLRGJVWVLYSRTA-OAHLLOKOSA-N |
| XLogP | 4.19 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|