C23H26N2O3 — CID 97148435
[(3R)-3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-(3,5-dimethyl-1H-indol-2-yl)methanone (PubChem CID 97148435) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(3R)-3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-(3,5-dimethyl-1H-indol-2-yl)methanone.
| Compound Name | [(3R)-3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-(3,5-dimethyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 97148435 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [(3R)-3-(2,3-dimethoxyphenyl)pyrrolidin-1-yl]-(3,5-dimethyl-1H-indol-2-yl)methanone |
| SMILES | COc1cccc([C@H]2CCN(C(=O)c3[nH]c4ccc(C)cc4c3C)C2)c1OC |
| InChI | InChI=1S/C23H26N2O3/c1-14-8-9-19-18(12-14)15(2)21(24-19)23(26)25-11-10-16(13-25)17-6-5-7-20(27-3)22(17)28-4/h5-9,12,16,24H,10-11,13H2,1-4H3/t16-/m0/s1 |
| InChIKey | JQWYIVORVVUUFD-INIZCTEOSA-N |
| XLogP | 4.43 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|