C20H26FN3O — CID 95718011
(3S)-1-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]-3-[(2-fluorophenoxy)methyl]piperidine (PubChem CID 95718011) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is (3S)-1-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]-3-[(2-fluorophenoxy)methyl]piperidine.
| Compound Name | (3S)-1-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]-3-[(2-fluorophenoxy)methyl]piperidine |
|---|---|
| PubChem CID | 95718011 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (3S)-1-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]-3-[(2-fluorophenoxy)methyl]piperidine |
| SMILES | Cn1ncc(CN2CCC[C@H](COc3ccccc3F)C2)c1C1CC1 |
| InChI | InChI=1S/C20H26FN3O/c1-23-20(16-8-9-16)17(11-22-23)13-24-10-4-5-15(12-24)14-25-19-7-3-2-6-18(19)21/h2-3,6-7,11,15-16H,4-5,8-10,12-14H2,1H3/t15-/m0/s1 |
| InChIKey | KOAGHIMUMBPDMO-HNNXBMFYSA-N |
| XLogP | 3.73 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |