C21H27N3O — CID 95870310
1-[(3S)-1-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]piperidin-3-yl]-2-phenylethanone (PubChem CID 95870310) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-[(3S)-1-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]piperidin-3-yl]-2-phenylethanone.
| Compound Name | 1-[(3S)-1-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]piperidin-3-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 95870310 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-[(3S)-1-[(5-cyclopropyl-1-methylpyrazol-4-yl)methyl]piperidin-3-yl]-2-phenylethanone |
| SMILES | Cn1ncc(CN2CCC[C@H](C(=O)Cc3ccccc3)C2)c1C1CC1 |
| InChI | InChI=1S/C21H27N3O/c1-23-21(17-9-10-17)19(13-22-23)15-24-11-5-8-18(14-24)20(25)12-16-6-3-2-4-7-16/h2-4,6-7,13,17-18H,5,8-12,14-15H2,1H3/t18-/m0/s1 |
| InChIKey | CEUFHYAYZSQEFS-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |