C19H23N3O3S — CID 95718120
[(2S)-1-(3-methyl-1-benzothiophene-2-carbonyl)piperazin-2-yl]-morpholin-4-ylmethanone (PubChem CID 95718120) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is [(2S)-1-(3-methyl-1-benzothiophene-2-carbonyl)piperazin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2S)-1-(3-methyl-1-benzothiophene-2-carbonyl)piperazin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 95718120 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [(2S)-1-(3-methyl-1-benzothiophene-2-carbonyl)piperazin-2-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1c(C(=O)N2CCNC[C@H]2C(=O)N2CCOCC2)sc2ccccc12 |
| InChI | InChI=1S/C19H23N3O3S/c1-13-14-4-2-3-5-16(14)26-17(13)19(24)22-7-6-20-12-15(22)18(23)21-8-10-25-11-9-21/h2-5,15,20H,6-12H2,1H3/t15-/m0/s1 |
| InChIKey | VZTUOYRIHANIAK-HNNXBMFYSA-N |
| XLogP | 1.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |