C18H26FN5 — CID 95719167
(3R)-3-[2-(2-fluorophenyl)ethyl]-1-[3-(5-methyltetrazol-1-yl)propyl]piperidine (PubChem CID 95719167) has the molecular formula C18H26FN5 and a molecular weight of 331.44 g/mol. Its IUPAC name is (3R)-3-[2-(2-fluorophenyl)ethyl]-1-[3-(5-methyltetrazol-1-yl)propyl]piperidine.
| Compound Name | (3R)-3-[2-(2-fluorophenyl)ethyl]-1-[3-(5-methyltetrazol-1-yl)propyl]piperidine |
|---|---|
| PubChem CID | 95719167 |
| Molecular Formula | C18H26FN5 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | (3R)-3-[2-(2-fluorophenyl)ethyl]-1-[3-(5-methyltetrazol-1-yl)propyl]piperidine |
| SMILES | Cc1nnnn1CCCN1CCC[C@@H](CCc2ccccc2F)C1 |
| InChI | InChI=1S/C18H26FN5/c1-15-20-21-22-24(15)13-5-12-23-11-4-6-16(14-23)9-10-17-7-2-3-8-18(17)19/h2-3,7-8,16H,4-6,9-14H2,1H3/t16-/m0/s1 |
| InChIKey | NVKDEPQCVAAZNF-INIZCTEOSA-N |
| XLogP | 2.86 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |