C15H21N5 — CID 95719321
[(2S)-1-[(1-phenyltriazol-4-yl)methyl]piperidin-2-yl]methanamine (PubChem CID 95719321) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is [(2S)-1-[(1-phenyltriazol-4-yl)methyl]piperidin-2-yl]methanamine.
| Compound Name | [(2S)-1-[(1-phenyltriazol-4-yl)methyl]piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 95719321 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | [(2S)-1-[(1-phenyltriazol-4-yl)methyl]piperidin-2-yl]methanamine |
| SMILES | NC[C@@H]1CCCCN1Cc1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C15H21N5/c16-10-15-8-4-5-9-19(15)11-13-12-20(18-17-13)14-6-2-1-3-7-14/h1-3,6-7,12,15H,4-5,8-11,16H2/t15-/m0/s1 |
| InChIKey | ALJISQYRRMXMDG-HNNXBMFYSA-N |
| XLogP | 1.58 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |