C21H26N4O2 — CID 95725095
(2S)-N-(6-methyl-3-pyridinyl)-1-(4-phenylbutanoyl)piperazine-2-carboxamide (PubChem CID 95725095) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (2S)-N-(6-methyl-3-pyridinyl)-1-(4-phenylbutanoyl)piperazine-2-carboxamide.
| Compound Name | (2S)-N-(6-methyl-3-pyridinyl)-1-(4-phenylbutanoyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 95725095 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (2S)-N-(6-methyl-3-pyridinyl)-1-(4-phenylbutanoyl)piperazine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CNCCN2C(=O)CCCc2ccccc2)cn1 |
| InChI | InChI=1S/C21H26N4O2/c1-16-10-11-18(14-23-16)24-21(27)19-15-22-12-13-25(19)20(26)9-5-8-17-6-3-2-4-7-17/h2-4,6-7,10-11,14,19,22H,5,8-9,12-13,15H2,1H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | MKNLFXLMVSKKII-IBGZPJMESA-N |
| XLogP | 2.15 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |