C18H19FN4O2S — CID 95723495
(2S)-N-(4-fluorophenyl)-1-(2-pyridin-4-ylsulfanylacetyl)piperazine-2-carboxamide (PubChem CID 95723495) has the molecular formula C18H19FN4O2S and a molecular weight of 374.44 g/mol. Its IUPAC name is (2S)-N-(4-fluorophenyl)-1-(2-pyridin-4-ylsulfanylacetyl)piperazine-2-carboxamide.
| Compound Name | (2S)-N-(4-fluorophenyl)-1-(2-pyridin-4-ylsulfanylacetyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 95723495 |
| Molecular Formula | C18H19FN4O2S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (2S)-N-(4-fluorophenyl)-1-(2-pyridin-4-ylsulfanylacetyl)piperazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)[C@@H]1CNCCN1C(=O)CSc1ccncc1 |
| InChI | InChI=1S/C18H19FN4O2S/c19-13-1-3-14(4-2-13)22-18(25)16-11-21-9-10-23(16)17(24)12-26-15-5-7-20-8-6-15/h1-8,16,21H,9-12H2,(H,22,25)/t16-/m0/s1 |
| InChIKey | WYXOZTRSPIQSAN-INIZCTEOSA-N |
| XLogP | 1.75 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |