C13H19ClN2 — CID 95731896
N-[(3-chlorophenyl)methyl]-1-[(3S)-piperidin-3-yl]methanamine (PubChem CID 95731896) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-1-[(3S)-piperidin-3-yl]methanamine.
| Compound Name | N-[(3-chlorophenyl)methyl]-1-[(3S)-piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 95731896 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-1-[(3S)-piperidin-3-yl]methanamine |
| SMILES | Clc1cccc(CNC[C@H]2CCCNC2)c1 |
| InChI | InChI=1S/C13H19ClN2/c14-13-5-1-3-11(7-13)8-16-10-12-4-2-6-15-9-12/h1,3,5,7,12,15-16H,2,4,6,8-10H2/t12-/m0/s1 |
| InChIKey | LXZUYDDWGZWIRD-LBPRGKRZSA-N |
| XLogP | 2.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |