C18H20BrClN2 — CID 135174667
N-[[3-(2-bromo-4-chlorophenyl)phenyl]methyl]-1-pyrrolidin-3-ylmethanamine (PubChem CID 135174667) has the molecular formula C18H20BrClN2 and a molecular weight of 379.73 g/mol. Its IUPAC name is N-[[3-(2-bromo-4-chlorophenyl)phenyl]methyl]-1-pyrrolidin-3-ylmethanamine.
| Compound Name | N-[[3-(2-bromo-4-chlorophenyl)phenyl]methyl]-1-pyrrolidin-3-ylmethanamine |
|---|---|
| PubChem CID | 135174667 |
| Molecular Formula | C18H20BrClN2 |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-[[3-(2-bromo-4-chlorophenyl)phenyl]methyl]-1-pyrrolidin-3-ylmethanamine |
| SMILES | Clc1ccc(-c2cccc(CNCC3CCNC3)c2)c(Br)c1 |
| InChI | InChI=1S/C18H20BrClN2/c19-18-9-16(20)4-5-17(18)15-3-1-2-13(8-15)10-22-12-14-6-7-21-11-14/h1-5,8-9,14,21-22H,6-7,10-12H2 |
| InChIKey | JIVCUZJLUBHQAQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |