C21H23BrN2 — CID 135174165
N-[[3-[2-(2-bromo-4-methylphenyl)ethynyl]phenyl]methyl]-1-pyrrolidin-3-ylmethanamine (PubChem CID 135174165) has the molecular formula C21H23BrN2 and a molecular weight of 383.33 g/mol. Its IUPAC name is N-[[3-[2-(2-bromo-4-methylphenyl)ethynyl]phenyl]methyl]-1-pyrrolidin-3-ylmethanamine.
| Compound Name | N-[[3-[2-(2-bromo-4-methylphenyl)ethynyl]phenyl]methyl]-1-pyrrolidin-3-ylmethanamine |
|---|---|
| PubChem CID | 135174165 |
| Molecular Formula | C21H23BrN2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[[3-[2-(2-bromo-4-methylphenyl)ethynyl]phenyl]methyl]-1-pyrrolidin-3-ylmethanamine |
| SMILES | Cc1ccc(C#Cc2cccc(CNCC3CCNC3)c2)c(Br)c1 |
| InChI | InChI=1S/C21H23BrN2/c1-16-5-7-20(21(22)11-16)8-6-17-3-2-4-18(12-17)13-24-15-19-9-10-23-14-19/h2-5,7,11-12,19,23-24H,9-10,13-15H2,1H3 |
| InChIKey | YSBCYSAZZDNSTJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|