C19H23N3O2 — CID 95734380
[(3R)-3-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone (PubChem CID 95734380) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is [(3R)-3-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone.
| Compound Name | [(3R)-3-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone |
|---|---|
| PubChem CID | 95734380 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | [(3R)-3-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone |
| SMILES | Cc1nc([C@@H]2CCCN(C(=O)[C@H]3CCCc4ccccc43)C2)no1 |
| InChI | InChI=1S/C19H23N3O2/c1-13-20-18(21-24-13)15-8-5-11-22(12-15)19(23)17-10-4-7-14-6-2-3-9-16(14)17/h2-3,6,9,15,17H,4-5,7-8,10-12H2,1H3/t15-,17+/m1/s1 |
| InChIKey | XNARQBNIJSBNQX-WBVHZDCISA-N |
| XLogP | 3.20 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |