C18H29N3O — CID 95740921
1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)propan-1-one (PubChem CID 95740921) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)propan-1-one.
| Compound Name | 1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 95740921 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-3-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)propan-1-one |
| SMILES | C=CCn1nc(C)c(CCC(=O)N2C[C@H](C)C[C@@H](C)C2)c1C |
| InChI | InChI=1S/C18H29N3O/c1-6-9-21-16(5)17(15(4)19-21)7-8-18(22)20-11-13(2)10-14(3)12-20/h6,13-14H,1,7-12H2,2-5H3/t13-,14-/m1/s1 |
| InChIKey | XVPLOHUDYAENSW-ZIAGYGMSSA-N |
| XLogP | 3.12 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|